ChemNet > CAS > 57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
نام محصول |
methyl 2-[(cyanomethyl)thio]benzoate |
نام انگلیسی |
methyl 2-[(cyanomethyl)thio]benzoate;methyl 2-[(cyanomethyl)sulfanyl]benzoate |
میدان مغناطیسی |
C10H9NO2S |
وزن مولکولی |
207.249 |
InChI |
InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
شماره سیایاس |
57601-89-5 |
ساختار مولکولی |
|
تراکم |
1.24g/cm3 |
نقطه ذوب |
121℃ |
نقطه غلیان |
338.6°C at 760 mmHg |
ضریب شکست |
1.574 |
نقطه اشتعال |
158.6°C |
فشار بخار |
9.69E-05mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|